C44H55NO6Si — CID 11320101
tert-butyl (2R,3R,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(3-oxobutyl)-3,4-bis(phenylmethoxy)pyrrolidine-1-carboxylate (PubChem CID 11320101) has the molecular formula C44H55NO6Si and a molecular weight of 722.01 g/mol. Its IUPAC name is tert-butyl (2R,3R,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(3-oxobutyl)-3,4-bis(phenylmethoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(3-oxobutyl)-3,4-bis(phenylmethoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11320101 |
| Molecular Formula | C44H55NO6Si |
| Molecular Weight | 722.01 g/mol |
| Exact Mass | 721.38 |
| IUPAC Name | tert-butyl (2R,3R,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(3-oxobutyl)-3,4-bis(phenylmethoxy)pyrrolidine-1-carboxylate |
| SMILES | CC(=O)CC[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C44H55NO6Si/c1-33(46)28-29-38-40(48-30-34-20-12-8-13-21-34)41(49-31-35-22-14-9-15-23-35)39(45(38)42(47)51-43(2,3)4)32-50-52(44(5,6)7,36-24-16-10-17-25-36)37-26-18-11-19-27-37/h8-27,38-41H,28-32H2,1-7H3/t38-,39-,40-,41-/m1/s1 |
| InChIKey | JECLOVDUHZCMRU-GAKQXGIYSA-N |
| XLogP | 8.09 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.01 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|