C37H41NO4Si — CID 139089681
(4S,5R)-3-benzyl-5-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylmethoxyethyl]-4-ethenyl-1,3-oxazolidin-2-one (PubChem CID 139089681) has the molecular formula C37H41NO4Si and a molecular weight of 591.82 g/mol. Its IUPAC name is (4S,5R)-3-benzyl-5-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylmethoxyethyl]-4-ethenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-benzyl-5-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylmethoxyethyl]-4-ethenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139089681 |
| Molecular Formula | C37H41NO4Si |
| Molecular Weight | 591.82 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | (4S,5R)-3-benzyl-5-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylmethoxyethyl]-4-ethenyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@H]1[C@H]([C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OCc2ccccc2)OC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C37H41NO4Si/c1-5-33-35(42-36(39)38(33)26-29-18-10-6-11-19-29)34(40-27-30-20-12-7-13-21-30)28-41-43(37(2,3)4,31-22-14-8-15-23-31)32-24-16-9-17-25-32/h5-25,33-35H,1,26-28H2,2-4H3/t33-,34+,35+/m0/s1 |
| InChIKey | HQEPGBLIWHWVAT-BMPTZRATSA-N |
| XLogP | 6.72 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.82 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|