C35H41NO6 — CID 134973092
tert-butyl (2R,3S,4R,5S)-2-[(E)-3-oxobut-1-enyl]-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 134973092) has the molecular formula C35H41NO6 and a molecular weight of 571.71 g/mol. Its IUPAC name is tert-butyl (2R,3S,4R,5S)-2-[(E)-3-oxobut-1-enyl]-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S,4R,5S)-2-[(E)-3-oxobut-1-enyl]-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134973092 |
| Molecular Formula | C35H41NO6 |
| Molecular Weight | 571.71 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | tert-butyl (2R,3S,4R,5S)-2-[(E)-3-oxobut-1-enyl]-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(=O)/C=C/[C@@H]1[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](COCc2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H41NO6/c1-26(37)20-21-30-32(40-23-28-16-10-6-11-17-28)33(41-24-29-18-12-7-13-19-29)31(36(30)34(38)42-35(2,3)4)25-39-22-27-14-8-5-9-15-27/h5-21,30-33H,22-25H2,1-4H3/b21-20+/t30-,31+,32+,33-/m1/s1 |
| InChIKey | OYFUMQSIZLXCIQ-NLXFGNHPSA-N |
| XLogP | 6.51 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.71 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|