C28H28F3NO4 — CID 70147532
1-[(2R,3R,4R)-2,3,5-trifluoro-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)pyrrolidin-1-yl]ethanone (PubChem CID 70147532) has the molecular formula C28H28F3NO4 and a molecular weight of 499.53 g/mol. Its IUPAC name is 1-[(2R,3R,4R)-2,3,5-trifluoro-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(2R,3R,4R)-2,3,5-trifluoro-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 70147532 |
| Molecular Formula | C28H28F3NO4 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 1-[(2R,3R,4R)-2,3,5-trifluoro-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1C(F)[C@@H](OCc2ccccc2)[C@](F)(OCc2ccccc2)[C@]1(F)COCc1ccccc1 |
| InChI | InChI=1S/C28H28F3NO4/c1-21(33)32-26(29)25(35-18-23-13-7-3-8-14-23)28(31,36-19-24-15-9-4-10-16-24)27(32,30)20-34-17-22-11-5-2-6-12-22/h2-16,25-26H,17-20H2,1H3/t25-,26?,27+,28+/m1/s1 |
| InChIKey | AEHAABAAXZYNBH-LBSFNXSNSA-N |
| XLogP | 5.49 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|