C38H43NO6Si — CID 11308188
(1S,2R,5R,6R,7R,8R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dihydroxy-6,7-bis(phenylmethoxy)-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 11308188) has the molecular formula C38H43NO6Si and a molecular weight of 637.85 g/mol. Its IUPAC name is (1S,2R,5R,6R,7R,8R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dihydroxy-6,7-bis(phenylmethoxy)-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (1S,2R,5R,6R,7R,8R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dihydroxy-6,7-bis(phenylmethoxy)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 11308188 |
| Molecular Formula | C38H43NO6Si |
| Molecular Weight | 637.85 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | (1S,2R,5R,6R,7R,8R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dihydroxy-6,7-bis(phenylmethoxy)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | CC(C)(C)[Si](OC[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]2[C@H](O)[C@@H](O)C(=O)N21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H43NO6Si/c1-38(2,3)46(29-20-12-6-13-21-29,30-22-14-7-15-23-30)45-26-31-35(43-24-27-16-8-4-9-17-27)36(44-25-28-18-10-5-11-19-28)32-33(40)34(41)37(42)39(31)32/h4-23,31-36,40-41H,24-26H2,1-3H3/t31-,32-,33+,34-,35-,36-/m1/s1 |
| InChIKey | PVILLOYDBRLEPW-DWJBRYGOSA-N |
| XLogP | 4.05 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.85 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|