C45H55NO7Si — CID 11050937
(4S)-4-benzyl-3-[(2S,3R,5R,6S)-7-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-5-methoxy-6-methyl-2-[(E)-3-phenylmethoxyprop-1-enyl]heptanoyl]-1,3-oxazolidin-2-one (PubChem CID 11050937) has the molecular formula C45H55NO7Si and a molecular weight of 750.02 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S,3R,5R,6S)-7-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-5-methoxy-6-methyl-2-[(E)-3-phenylmethoxyprop-1-enyl]heptanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S,3R,5R,6S)-7-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-5-methoxy-6-methyl-2-[(E)-3-phenylmethoxyprop-1-enyl]heptanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11050937 |
| Molecular Formula | C45H55NO7Si |
| Molecular Weight | 750.02 g/mol |
| Exact Mass | 749.37 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S,3R,5R,6S)-7-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-5-methoxy-6-methyl-2-[(E)-3-phenylmethoxyprop-1-enyl]heptanoyl]-1,3-oxazolidin-2-one |
| SMILES | CO[C@H](C[C@@H](O)[C@H](/C=C/COCc1ccccc1)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C45H55NO7Si/c1-34(31-53-54(45(2,3)4,38-23-14-8-15-24-38)39-25-16-9-17-26-39)42(50-5)30-41(47)40(27-18-28-51-32-36-21-12-7-13-22-36)43(48)46-37(33-52-44(46)49)29-35-19-10-6-11-20-35/h6-27,34,37,40-42,47H,28-33H2,1-5H3/b27-18+/t34-,37-,40-,41+,42+/m0/s1 |
| InChIKey | GIYYWFYVPZONIO-SQZKBWAKSA-N |
| XLogP | 6.94 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.02 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|