C24H29NO6 — CID 11293261
(2R,5R,6R,7R,8R)-2-hydroxy-7-(methoxymethoxy)-6-phenylmethoxy-5-(phenylmethoxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 11293261) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is (2R,5R,6R,7R,8R)-2-hydroxy-7-(methoxymethoxy)-6-phenylmethoxy-5-(phenylmethoxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (2R,5R,6R,7R,8R)-2-hydroxy-7-(methoxymethoxy)-6-phenylmethoxy-5-(phenylmethoxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 11293261 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | (2R,5R,6R,7R,8R)-2-hydroxy-7-(methoxymethoxy)-6-phenylmethoxy-5-(phenylmethoxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | COCO[C@H]1[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)N2C(=O)[C@H](O)C[C@H]12 |
| InChI | InChI=1S/C24H29NO6/c1-28-16-31-22-19-12-21(26)24(27)25(19)20(15-29-13-17-8-4-2-5-9-17)23(22)30-14-18-10-6-3-7-11-18/h2-11,19-23,26H,12-16H2,1H3/t19-,20-,21-,22-,23-/m1/s1 |
| InChIKey | AXLOLKKUTRTFIV-GNJRFXKQSA-N |
| XLogP | 2.12 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|