C22H23NO4 — CID 135022498
(2S,3aR,4R,8aR,8bS)-2-phenyl-4-(phenylmethoxymethyl)-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-6-one (PubChem CID 135022498) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is (2S,3aR,4R,8aR,8bS)-2-phenyl-4-(phenylmethoxymethyl)-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-6-one.
| Compound Name | (2S,3aR,4R,8aR,8bS)-2-phenyl-4-(phenylmethoxymethyl)-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-6-one |
|---|---|
| PubChem CID | 135022498 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (2S,3aR,4R,8aR,8bS)-2-phenyl-4-(phenylmethoxymethyl)-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-6-one |
| SMILES | O=C1CC[C@@H]2[C@@H]3O[C@H](c4ccccc4)O[C@@H]3[C@@H](COCc3ccccc3)N12 |
| InChI | InChI=1S/C22H23NO4/c24-19-12-11-17-20-21(27-22(26-20)16-9-5-2-6-10-16)18(23(17)19)14-25-13-15-7-3-1-4-8-15/h1-10,17-18,20-22H,11-14H2/t17-,18-,20+,21-,22+/m1/s1 |
| InChIKey | DWAKBQPYVWABLV-MPAQAYSTSA-N |
| XLogP | 3.06 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |