C26H39NO6 — CID 10139550
N-[(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl]-N-(3-methoxypropyl)cyclohexanecarboxamide (PubChem CID 10139550) has the molecular formula C26H39NO6 and a molecular weight of 461.60 g/mol. Its IUPAC name is N-[(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl]-N-(3-methoxypropyl)cyclohexanecarboxamide.
| Compound Name | N-[(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl]-N-(3-methoxypropyl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 10139550 |
| Molecular Formula | C26H39NO6 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | N-[(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl]-N-(3-methoxypropyl)cyclohexanecarboxamide |
| SMILES | COCCCN(CC1OC2OC(C)(C)OC2C1OCc1ccccc1)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C26H39NO6/c1-26(2)32-23-22(30-18-19-11-6-4-7-12-19)21(31-25(23)33-26)17-27(15-10-16-29-3)24(28)20-13-8-5-9-14-20/h4,6-7,11-12,20-23,25H,5,8-10,13-18H2,1-3H3 |
| InChIKey | NZFAAGUTKNMKGF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|