C28H44N2O5 — CID 10141114
N-[2-(diethylamino)ethyl]-N-[(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl]cyclohexanecarboxamide (PubChem CID 10141114) has the molecular formula C28H44N2O5 and a molecular weight of 488.67 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-[(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl]cyclohexanecarboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-[(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 10141114 |
| Molecular Formula | C28H44N2O5 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-[(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl]cyclohexanecarboxamide |
| SMILES | CCN(CC)CCN(CC1OC2OC(C)(C)OC2C1OCc1ccccc1)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C28H44N2O5/c1-5-29(6-2)17-18-30(26(31)22-15-11-8-12-16-22)19-23-24(32-20-21-13-9-7-10-14-21)25-27(33-23)35-28(3,4)34-25/h7,9-10,13-14,22-25,27H,5-6,8,11-12,15-20H2,1-4H3 |
| InChIKey | UXLRGBPKALTGRR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |