C28H35NO5 — CID 134944875
(E)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-benzyl-N,N-diethylprop-2-enamide (PubChem CID 134944875) has the molecular formula C28H35NO5 and a molecular weight of 465.59 g/mol. Its IUPAC name is (E)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-benzyl-N,N-diethylprop-2-enamide.
| Compound Name | (E)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-benzyl-N,N-diethylprop-2-enamide |
|---|---|
| PubChem CID | 134944875 |
| Molecular Formula | C28H35NO5 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | (E)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-benzyl-N,N-diethylprop-2-enamide |
| SMILES | CCN(CC)C(=O)/C(=C/[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H35NO5/c1-5-29(6-2)26(30)22(17-20-13-9-7-10-14-20)18-23-24(31-19-21-15-11-8-12-16-21)25-27(32-23)34-28(3,4)33-25/h7-16,18,23-25,27H,5-6,17,19H2,1-4H3/b22-18+/t23-,24+,25-,27-/m1/s1 |
| InChIKey | DQCXKBBCIKMTOX-XSGIFZIOSA-N |
| XLogP | 4.49 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|