C21H32N2O5 — CID 22670346
2-(diethylamino)-N-[(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl]acetamide (PubChem CID 22670346) has the molecular formula C21H32N2O5 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-(diethylamino)-N-[(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl]acetamide.
| Compound Name | 2-(diethylamino)-N-[(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl]acetamide |
|---|---|
| PubChem CID | 22670346 |
| Molecular Formula | C21H32N2O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 2-(diethylamino)-N-[(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl]acetamide |
| SMILES | CCN(CC)CC(=O)NCC1OC2OC(C)(C)OC2C1OCc1ccccc1 |
| InChI | InChI=1S/C21H32N2O5/c1-5-23(6-2)13-17(24)22-12-16-18(25-14-15-10-8-7-9-11-15)19-20(26-16)28-21(3,4)27-19/h7-11,16,18-20H,5-6,12-14H2,1-4H3,(H,22,24) |
| InChIKey | RMJNZECGHIWHDF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |