C18H24N4O6 — CID 134838069
methyl N-[(2R)-2-[(3aR,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-azidoethyl]carbamate (PubChem CID 134838069) has the molecular formula C18H24N4O6 and a molecular weight of 392.41 g/mol. Its IUPAC name is methyl N-[(2R)-2-[(3aR,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-azidoethyl]carbamate.
| Compound Name | methyl N-[(2R)-2-[(3aR,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-azidoethyl]carbamate |
|---|---|
| PubChem CID | 134838069 |
| Molecular Formula | C18H24N4O6 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | methyl N-[(2R)-2-[(3aR,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-azidoethyl]carbamate |
| SMILES | COC(=O)NC[C@@H](N=[N+]=[N-])C1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C18H24N4O6/c1-18(2)27-15-14(25-10-11-7-5-4-6-8-11)13(26-16(15)28-18)12(21-22-19)9-20-17(23)24-3/h4-8,12-16H,9-10H2,1-3H3,(H,20,23)/t12-,13?,14+,15-,16-/m1/s1 |
| InChIKey | KEJMQVQRHWJUKI-FHNRHNHASA-N |
| XLogP | 2.48 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|