C26H38N4O8 — CID 135033526
tert-butyl (2S,3R)-3-[[(4R,6R)-6-(azidomethyl)-2,2-diethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxy]-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 135033526) has the molecular formula C26H38N4O8 and a molecular weight of 534.61 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-[[(4R,6R)-6-(azidomethyl)-2,2-diethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxy]-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | tert-butyl (2S,3R)-3-[[(4R,6R)-6-(azidomethyl)-2,2-diethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxy]-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 135033526 |
| Molecular Formula | C26H38N4O8 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | tert-butyl (2S,3R)-3-[[(4R,6R)-6-(azidomethyl)-2,2-diethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxy]-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CCC1(CC)OC2C(O1)[C@@H](CN=[N+]=[N-])O[C@H]2O[C@H](C)[C@H](NC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H38N4O8/c1-7-26(8-2)36-20-18(14-28-30-27)35-23(21(20)37-26)34-16(3)19(22(31)38-25(4,5)6)29-24(32)33-15-17-12-10-9-11-13-17/h9-13,16,18-21,23H,7-8,14-15H2,1-6H3,(H,29,32)/t16-,18-,19+,20?,21?,23-/m1/s1 |
| InChIKey | QHRSFSCXAHDOIY-JAXJBPOFSA-N |
| XLogP | 4.36 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|