C17H20N4O5 — CID 66553538
benzyl (1S,2R,6R,8S,9S)-9-azido-4,4-dimethyl-3,5,7-trioxa-11-azatricyclo[6.3.0.02,6]undecane-11-carboxylate (PubChem CID 66553538) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is benzyl (1S,2R,6R,8S,9S)-9-azido-4,4-dimethyl-3,5,7-trioxa-11-azatricyclo[6.3.0.02,6]undecane-11-carboxylate.
| Compound Name | benzyl (1S,2R,6R,8S,9S)-9-azido-4,4-dimethyl-3,5,7-trioxa-11-azatricyclo[6.3.0.02,6]undecane-11-carboxylate |
|---|---|
| PubChem CID | 66553538 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | benzyl (1S,2R,6R,8S,9S)-9-azido-4,4-dimethyl-3,5,7-trioxa-11-azatricyclo[6.3.0.02,6]undecane-11-carboxylate |
| SMILES | CC1(C)O[C@H]2O[C@H]3[C@@H]([C@H]2O1)N(C(=O)OCc1ccccc1)C[C@@H]3N=[N+]=[N-] |
| InChI | InChI=1S/C17H20N4O5/c1-17(2)25-14-12-13(24-15(14)26-17)11(19-20-18)8-21(12)16(22)23-9-10-6-4-3-5-7-10/h3-7,11-15H,8-9H2,1-2H3/t11-,12-,13+,14+,15+/m0/s1 |
| InChIKey | SAADFRMXNPKRRA-VQJWOFKYSA-N |
| XLogP | 2.56 |
| TPSA | 105.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|