C26H29NO6 — CID 134878119
4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzylpiperidine-2,6-dione (PubChem CID 134878119) has the molecular formula C26H29NO6 and a molecular weight of 451.52 g/mol. Its IUPAC name is 4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzylpiperidine-2,6-dione.
| Compound Name | 4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 134878119 |
| Molecular Formula | C26H29NO6 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzylpiperidine-2,6-dione |
| SMILES | CC1(C)O[C@H]2O[C@H](C3CC(=O)N(Cc4ccccc4)C(=O)C3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C26H29NO6/c1-26(2)32-24-23(30-16-18-11-7-4-8-12-18)22(31-25(24)33-26)19-13-20(28)27(21(29)14-19)15-17-9-5-3-6-10-17/h3-12,19,22-25H,13-16H2,1-2H3/t22-,23+,24-,25-/m1/s1 |
| InChIKey | ZBMHLGXYWLUQMR-ZFFYZDHPSA-N |
| XLogP | 3.41 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|