C27H47NO6Si2 — CID 101194326
(3aS,4S,5R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(phenylmethoxymethyl)-3a,4,5,7-tetrahydro-3H-[1,2]oxazolo[2,3-c][1,3]oxazin-2-one (PubChem CID 101194326) has the molecular formula C27H47NO6Si2 and a molecular weight of 537.85 g/mol. Its IUPAC name is (3aS,4S,5R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(phenylmethoxymethyl)-3a,4,5,7-tetrahydro-3H-[1,2]oxazolo[2,3-c][1,3]oxazin-2-one.
| Compound Name | (3aS,4S,5R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(phenylmethoxymethyl)-3a,4,5,7-tetrahydro-3H-[1,2]oxazolo[2,3-c][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 101194326 |
| Molecular Formula | C27H47NO6Si2 |
| Molecular Weight | 537.85 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | (3aS,4S,5R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(phenylmethoxymethyl)-3a,4,5,7-tetrahydro-3H-[1,2]oxazolo[2,3-c][1,3]oxazin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](COCc2ccccc2)N2OC(=O)C[C@H]2[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H47NO6Si2/c1-26(2,3)35(7,8)31-18-22-25(34-36(9,10)27(4,5)6)21-16-24(29)33-28(21)23(32-22)19-30-17-20-14-12-11-13-15-20/h11-15,21-23,25H,16-19H2,1-10H3/t21-,22+,23-,25-/m0/s1 |
| InChIKey | GZILUNHCXGOSLJ-AANQFLQQSA-N |
| XLogP | 5.87 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.85 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|