C22H27NO4 — CID 10642841
(3aR,6S,7R,7aS)-1-methyl-7-phenylmethoxy-6-(phenylmethoxymethyl)-3,3a,4,6,7,7a-hexahydropyrano[4,3-c][1,2]oxazole (PubChem CID 10642841) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is (3aR,6S,7R,7aS)-1-methyl-7-phenylmethoxy-6-(phenylmethoxymethyl)-3,3a,4,6,7,7a-hexahydropyrano[4,3-c][1,2]oxazole.
| Compound Name | (3aR,6S,7R,7aS)-1-methyl-7-phenylmethoxy-6-(phenylmethoxymethyl)-3,3a,4,6,7,7a-hexahydropyrano[4,3-c][1,2]oxazole |
|---|---|
| PubChem CID | 10642841 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (3aR,6S,7R,7aS)-1-methyl-7-phenylmethoxy-6-(phenylmethoxymethyl)-3,3a,4,6,7,7a-hexahydropyrano[4,3-c][1,2]oxazole |
| SMILES | CN1OC[C@H]2CO[C@@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@H]21 |
| InChI | InChI=1S/C22H27NO4/c1-23-21-19(15-27-23)14-25-20(16-24-12-17-8-4-2-5-9-17)22(21)26-13-18-10-6-3-7-11-18/h2-11,19-22H,12-16H2,1H3/t19-,20+,21+,22+/m1/s1 |
| InChIKey | FBKSEFMBDILPGU-MLNNCEHLSA-N |
| XLogP | 3.05 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |