C23H27NO4 — CID 102033886
(1S,4R,7R,11S)-10-benzyl-6,6-dimethyl-11-phenylmethoxy-2,5,9-trioxa-10-azatricyclo[5.3.1.04,11]undecane (PubChem CID 102033886) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is (1S,4R,7R,11S)-10-benzyl-6,6-dimethyl-11-phenylmethoxy-2,5,9-trioxa-10-azatricyclo[5.3.1.04,11]undecane.
| Compound Name | (1S,4R,7R,11S)-10-benzyl-6,6-dimethyl-11-phenylmethoxy-2,5,9-trioxa-10-azatricyclo[5.3.1.04,11]undecane |
|---|---|
| PubChem CID | 102033886 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (1S,4R,7R,11S)-10-benzyl-6,6-dimethyl-11-phenylmethoxy-2,5,9-trioxa-10-azatricyclo[5.3.1.04,11]undecane |
| SMILES | CC1(C)O[C@@H]2CO[C@@H]3N(Cc4ccccc4)OC[C@H]1[C@@]32OCc1ccccc1 |
| InChI | InChI=1S/C23H27NO4/c1-22(2)19-15-27-24(13-17-9-5-3-6-10-17)21-23(19,20(28-22)16-25-21)26-14-18-11-7-4-8-12-18/h3-12,19-21H,13-16H2,1-2H3/t19-,20-,21+,23+/m1/s1 |
| InChIKey | QMFZMURXUNNXBM-JFYQVNSESA-N |
| XLogP | 3.54 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |