C22H33NO4 — CID 25209656
(1S,4R,7R,11S)-10-benzyl-11-(3,3-dimethylbutoxy)-6,6-dimethyl-2,5,9-trioxa-10-azatricyclo[5.3.1.04,11]undecane (PubChem CID 25209656) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is (1S,4R,7R,11S)-10-benzyl-11-(3,3-dimethylbutoxy)-6,6-dimethyl-2,5,9-trioxa-10-azatricyclo[5.3.1.04,11]undecane.
| Compound Name | (1S,4R,7R,11S)-10-benzyl-11-(3,3-dimethylbutoxy)-6,6-dimethyl-2,5,9-trioxa-10-azatricyclo[5.3.1.04,11]undecane |
|---|---|
| PubChem CID | 25209656 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | (1S,4R,7R,11S)-10-benzyl-11-(3,3-dimethylbutoxy)-6,6-dimethyl-2,5,9-trioxa-10-azatricyclo[5.3.1.04,11]undecane |
| SMILES | CC(C)(C)CCO[C@]12[C@@H]3OC[C@H]1OC(C)(C)[C@H]2CON3Cc1ccccc1 |
| InChI | InChI=1S/C22H33NO4/c1-20(2,3)11-12-25-22-17-14-26-23(13-16-9-7-6-8-10-16)19(22)24-15-18(22)27-21(17,4)5/h6-10,17-19H,11-15H2,1-5H3/t17-,18-,19+,22+/m1/s1 |
| InChIKey | GMSFIYWTHLKXDA-IWQHBPENSA-N |
| XLogP | 3.78 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |