C18H23NO5 — CID 139094058
(1S,2R,6S,9S,12S)-15-benzyl-4,4-dimethyl-3,5,8,10,14-pentaoxa-15-azatetracyclo[7.6.0.01,12.02,6]pentadecane (PubChem CID 139094058) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is (1S,2R,6S,9S,12S)-15-benzyl-4,4-dimethyl-3,5,8,10,14-pentaoxa-15-azatetracyclo[7.6.0.01,12.02,6]pentadecane.
| Compound Name | (1S,2R,6S,9S,12S)-15-benzyl-4,4-dimethyl-3,5,8,10,14-pentaoxa-15-azatetracyclo[7.6.0.01,12.02,6]pentadecane |
|---|---|
| PubChem CID | 139094058 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (1S,2R,6S,9S,12S)-15-benzyl-4,4-dimethyl-3,5,8,10,14-pentaoxa-15-azatetracyclo[7.6.0.01,12.02,6]pentadecane |
| SMILES | CC1(C)O[C@H]2CO[C@@H]3OC[C@H]4CON(Cc5ccccc5)[C@]43[C@H]2O1 |
| InChI | InChI=1S/C18H23NO5/c1-17(2)23-14-11-21-16-18(15(14)24-17)13(9-20-16)10-22-19(18)8-12-6-4-3-5-7-12/h3-7,13-16H,8-11H2,1-2H3/t13-,14-,15-,16-,18-/m0/s1 |
| InChIKey | DBDQBFJLQZKTJX-DNCCFGNJSA-N |
| XLogP | 1.70 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |