C17H23NO4 — CID 102033887
(1S,4S,7R,8R)-9-benzyl-7-methoxy-2,2-dimethyl-3,6,10-trioxa-9-azatricyclo[5.4.0.04,8]undecane (PubChem CID 102033887) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (1S,4S,7R,8R)-9-benzyl-7-methoxy-2,2-dimethyl-3,6,10-trioxa-9-azatricyclo[5.4.0.04,8]undecane.
| Compound Name | (1S,4S,7R,8R)-9-benzyl-7-methoxy-2,2-dimethyl-3,6,10-trioxa-9-azatricyclo[5.4.0.04,8]undecane |
|---|---|
| PubChem CID | 102033887 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (1S,4S,7R,8R)-9-benzyl-7-methoxy-2,2-dimethyl-3,6,10-trioxa-9-azatricyclo[5.4.0.04,8]undecane |
| SMILES | CO[C@@]12OC[C@H]3OC(C)(C)[C@@H]1CON(Cc1ccccc1)[C@H]32 |
| InChI | InChI=1S/C17H23NO4/c1-16(2)14-11-21-18(9-12-7-5-4-6-8-12)15-13(22-16)10-20-17(14,15)19-3/h4-8,13-15H,9-11H2,1-3H3/t13-,14+,15-,17-/m1/s1 |
| InChIKey | QONUJRUKDSSTAD-JYYAWHABSA-N |
| XLogP | 1.97 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |