C19H28NO4+ — CID 174195413
11-benzyl-4,9-dimethoxy-4,11-dimethyl-3,5-dioxa-11-azoniatricyclo[5.3.1.02,6]undecane (PubChem CID 174195413) has the molecular formula C19H28NO4+ and a molecular weight of 334.44 g/mol. Its IUPAC name is 11-benzyl-4,9-dimethoxy-4,11-dimethyl-3,5-dioxa-11-azoniatricyclo[5.3.1.02,6]undecane.
| Compound Name | 11-benzyl-4,9-dimethoxy-4,11-dimethyl-3,5-dioxa-11-azoniatricyclo[5.3.1.02,6]undecane |
|---|---|
| PubChem CID | 174195413 |
| Molecular Formula | C19H28NO4+ |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 11-benzyl-4,9-dimethoxy-4,11-dimethyl-3,5-dioxa-11-azoniatricyclo[5.3.1.02,6]undecane |
| SMILES | COC1CC2C3OC(C)(OC)OC3C(C1)[N+]2(C)Cc1ccccc1 |
| InChI | InChI=1S/C19H28NO4/c1-19(22-4)23-17-15-10-14(21-3)11-16(18(17)24-19)20(15,2)12-13-8-6-5-7-9-13/h5-9,14-18H,10-12H2,1-4H3/q+1 |
| InChIKey | ITLGLFVBIRPSLY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|