C15H20FNO2 — CID 10563636
(3aR,4R,6aS)-5-benzyl-4-(fluoromethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole (PubChem CID 10563636) has the molecular formula C15H20FNO2 and a molecular weight of 265.33 g/mol. Its IUPAC name is (3aR,4R,6aS)-5-benzyl-4-(fluoromethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole.
| Compound Name | (3aR,4R,6aS)-5-benzyl-4-(fluoromethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
|---|---|
| PubChem CID | 10563636 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (3aR,4R,6aS)-5-benzyl-4-(fluoromethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
| SMILES | CC1(C)O[C@H]2[C@H](CN(Cc3ccccc3)[C@H]2CF)O1 |
| InChI | InChI=1S/C15H20FNO2/c1-15(2)18-13-10-17(12(8-16)14(13)19-15)9-11-6-4-3-5-7-11/h3-7,12-14H,8-10H2,1-2H3/t12-,13-,14+/m0/s1 |
| InChIKey | YWHJSJIDYXZHRW-MELADBBJSA-N |
| XLogP | 2.36 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |