C22H23NO5 — CID 10981805
(1S,2S,4R,7R,9R,12S,15R)-11-benzyl-4-phenyl-3,5,8,10,14-pentaoxa-11-azatetracyclo[7.5.1.02,7.012,15]pentadecane (PubChem CID 10981805) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is (1S,2S,4R,7R,9R,12S,15R)-11-benzyl-4-phenyl-3,5,8,10,14-pentaoxa-11-azatetracyclo[7.5.1.02,7.012,15]pentadecane.
| Compound Name | (1S,2S,4R,7R,9R,12S,15R)-11-benzyl-4-phenyl-3,5,8,10,14-pentaoxa-11-azatetracyclo[7.5.1.02,7.012,15]pentadecane |
|---|---|
| PubChem CID | 10981805 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (1S,2S,4R,7R,9R,12S,15R)-11-benzyl-4-phenyl-3,5,8,10,14-pentaoxa-11-azatetracyclo[7.5.1.02,7.012,15]pentadecane |
| SMILES | c1ccc(CN2O[C@H]3O[C@@H]4CO[C@@H](c5ccccc5)O[C@H]4[C@H]4OC[C@@H]2[C@@H]34)cc1 |
| InChI | InChI=1S/C22H23NO5/c1-3-7-14(8-4-1)11-23-16-12-24-20-18(16)22(28-23)26-17-13-25-21(27-19(17)20)15-9-5-2-6-10-15/h1-10,16-22H,11-13H2/t16-,17-,18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | MCLUJVNJOHGPGX-RAKJYYOCSA-N |
| XLogP | 2.66 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |