C24H27NO5 — CID 134881896
(1S,2S,4R,7R,9R)-4-phenyl-9-phenylmethoxy-3,5,8,16-tetraoxa-11-azatetracyclo[8.6.0.02,7.011,15]hexadecane (PubChem CID 134881896) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is (1S,2S,4R,7R,9R)-4-phenyl-9-phenylmethoxy-3,5,8,16-tetraoxa-11-azatetracyclo[8.6.0.02,7.011,15]hexadecane.
| Compound Name | (1S,2S,4R,7R,9R)-4-phenyl-9-phenylmethoxy-3,5,8,16-tetraoxa-11-azatetracyclo[8.6.0.02,7.011,15]hexadecane |
|---|---|
| PubChem CID | 134881896 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (1S,2S,4R,7R,9R)-4-phenyl-9-phenylmethoxy-3,5,8,16-tetraoxa-11-azatetracyclo[8.6.0.02,7.011,15]hexadecane |
| SMILES | c1ccc(CO[C@@H]2O[C@@H]3CO[C@@H](c4ccccc4)O[C@H]3[C@H]3OC4CCCN4C23)cc1 |
| InChI | InChI=1S/C24H27NO5/c1-3-8-16(9-4-1)14-26-24-20-22(29-19-12-7-13-25(19)20)21-18(28-24)15-27-23(30-21)17-10-5-2-6-11-17/h1-6,8-11,18-24H,7,12-15H2/t18-,19?,20?,21-,22+,23-,24-/m1/s1 |
| InChIKey | WBFIEQMIZVOQKV-BFGGTZDISA-N |
| XLogP | 3.23 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |