C28H35NO6 — CID 25209237
(3S)-2-benzyl-3-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-phenylmethoxy-3,6-dihydrooxazine (PubChem CID 25209237) has the molecular formula C28H35NO6 and a molecular weight of 481.59 g/mol. Its IUPAC name is (3S)-2-benzyl-3-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-phenylmethoxy-3,6-dihydrooxazine.
| Compound Name | (3S)-2-benzyl-3-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-phenylmethoxy-3,6-dihydrooxazine |
|---|---|
| PubChem CID | 25209237 |
| Molecular Formula | C28H35NO6 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | (3S)-2-benzyl-3-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-phenylmethoxy-3,6-dihydrooxazine |
| SMILES | CC1(C)O[C@H]([C@H]2C(OCc3ccccc3)=CCON2Cc2ccccc2)[C@@H]([C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C28H35NO6/c1-27(2)31-19-23(33-27)25-26(35-28(3,4)34-25)24-22(30-18-21-13-9-6-10-14-21)15-16-32-29(24)17-20-11-7-5-8-12-20/h5-15,23-26H,16-19H2,1-4H3/t23-,24-,25-,26-/m1/s1 |
| InChIKey | BMEFBDKOKOYDAJ-VEYUFSJPSA-N |
| XLogP | 4.57 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |