C21H25NO3 — CID 14979682
(3aS,5R,7aS)-1-benzyl-5-(phenylmethoxymethyl)-3,3a,4,5,7,7a-hexahydropyrano[3,4-c][1,2]oxazole (PubChem CID 14979682) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is (3aS,5R,7aS)-1-benzyl-5-(phenylmethoxymethyl)-3,3a,4,5,7,7a-hexahydropyrano[3,4-c][1,2]oxazole.
| Compound Name | (3aS,5R,7aS)-1-benzyl-5-(phenylmethoxymethyl)-3,3a,4,5,7,7a-hexahydropyrano[3,4-c][1,2]oxazole |
|---|---|
| PubChem CID | 14979682 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (3aS,5R,7aS)-1-benzyl-5-(phenylmethoxymethyl)-3,3a,4,5,7,7a-hexahydropyrano[3,4-c][1,2]oxazole |
| SMILES | c1ccc(COC[C@H]2C[C@@H]3CON(Cc4ccccc4)[C@@H]3CO2)cc1 |
| InChI | InChI=1S/C21H25NO3/c1-3-7-17(8-4-1)12-22-21-16-24-20(11-19(21)14-25-22)15-23-13-18-9-5-2-6-10-18/h1-10,19-21H,11-16H2/t19-,20-,21-/m1/s1 |
| InChIKey | VCUUZKIQRCIOLH-NJDAHSKKSA-N |
| XLogP | 3.42 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |