C27H31NO3 — CID 134831977
[(3R)-1-benzyl-3-phenylmethoxy-4-(phenylmethoxymethyl)pyrrolidin-2-yl]methanol (PubChem CID 134831977) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is [(3R)-1-benzyl-3-phenylmethoxy-4-(phenylmethoxymethyl)pyrrolidin-2-yl]methanol.
| Compound Name | [(3R)-1-benzyl-3-phenylmethoxy-4-(phenylmethoxymethyl)pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 134831977 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | [(3R)-1-benzyl-3-phenylmethoxy-4-(phenylmethoxymethyl)pyrrolidin-2-yl]methanol |
| SMILES | OCC1[C@H](OCc2ccccc2)C(COCc2ccccc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C27H31NO3/c29-18-26-27(31-20-24-14-8-3-9-15-24)25(21-30-19-23-12-6-2-7-13-23)17-28(26)16-22-10-4-1-5-11-22/h1-15,25-27,29H,16-21H2/t25?,26?,27-/m1/s1 |
| InChIKey | VMMBHFYXLCTQHR-WZDPVOGJSA-N |
| XLogP | 4.28 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |