About (1S,6R)-1,9-dimethyl-5-methylidenebicyclo[4.3.1]dec-8-en-3-one
(1S,6R)-1,9-dimethyl-5-methylidenebicyclo[4.3.1]dec-8-en-3-one (PubChem CID 100932753) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is (1S,6R)-1,9-dimethyl-5-methylidenebicyclo[4.3.1]dec-8-en-3-one.
Molecular Properties
| Compound Name | (1S,6R)-1,9-dimethyl-5-methylidenebicyclo[4.3.1]dec-8-en-3-one |
| PubChem CID | 100932753 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (1S,6R)-1,9-dimethyl-5-methylidenebicyclo[4.3.1]dec-8-en-3-one |
| SMILES | C=C1CC(=O)C[C@]2(C)C[C@H]1CC=C2C |
| InChI | InChI=1S/C13H18O/c1-9-6-12(14)8-13(3)7-11(9)5-4-10(13)2/h4,11H,1,5-8H2,2-3H3/t11-,13+/m1/s1 |
| InChIKey | JPDKOPLWYJBRRC-YPMHNXCESA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S,6R)-1,9-dimethyl-5-methylidenebicyclo[4.3.1]dec-8-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,6R)-1,9-dimethyl-5-methylidenebicyclo[4.3.1]dec-8-en-3-one?
The IUPAC name of (1S,6R)-1,9-dimethyl-5-methylidenebicyclo[4.3.1]dec-8-en-3-one (CID 100932753) is (1S,6R)-1,9-dimethyl-5-methylidenebicyclo[4.3.1]dec-8-en-3-one.
What is the SMILES notation for (1S,6R)-1,9-dimethyl-5-methylidenebicyclo[4.3.1]dec-8-en-3-one?
The canonical SMILES for (1S,6R)-1,9-dimethyl-5-methylidenebicyclo[4.3.1]dec-8-en-3-one is C=C1CC(=O)C[C@]2(C)C[C@H]1CC=C2C.
What is the InChIKey of (1S,6R)-1,9-dimethyl-5-methylidenebicyclo[4.3.1]dec-8-en-3-one?
The InChIKey is JPDKOPLWYJBRRC-YPMHNXCESA-N. The full InChI is InChI=1S/C13H18O/c1-9-6-12(14)8-13(3)7-11(9)5-4-10(13)2/h4,11H,1,5-8H2,2-3H3/t11-,13+/m1/s1.
What are the key properties of (1S,6R)-1,9-dimethyl-5-methylidenebicyclo[4.3.1]dec-8-en-3-one?
(1S,6R)-1,9-dimethyl-5-methylidenebicyclo[4.3.1]dec-8-en-3-one has a molecular weight of 190.29 g/mol, XLogP of 3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,6R)-1,9-dimethyl-5-methylidenebicyclo[4.3.1]dec-8-en-3-one is sourced from PubChem (CID 100932753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).