C24H20FN3O3 — CID 10093407
N-(2,6-dimethyl-4-pyridinyl)-2-[1-[(2-fluorophenyl)methyl]-7-hydroxyindol-3-yl]-2-oxoacetamide (PubChem CID 10093407) has the molecular formula C24H20FN3O3 and a molecular weight of 417.44 g/mol. Its IUPAC name is N-(2,6-dimethyl-4-pyridinyl)-2-[1-[(2-fluorophenyl)methyl]-7-hydroxyindol-3-yl]-2-oxoacetamide.
| Compound Name | N-(2,6-dimethyl-4-pyridinyl)-2-[1-[(2-fluorophenyl)methyl]-7-hydroxyindol-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 10093407 |
| Molecular Formula | C24H20FN3O3 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-(2,6-dimethyl-4-pyridinyl)-2-[1-[(2-fluorophenyl)methyl]-7-hydroxyindol-3-yl]-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)c2cn(Cc3ccccc3F)c3c(O)cccc23)cc(C)n1 |
| InChI | InChI=1S/C24H20FN3O3/c1-14-10-17(11-15(2)26-14)27-24(31)23(30)19-13-28(12-16-6-3-4-8-20(16)25)22-18(19)7-5-9-21(22)29/h3-11,13,29H,12H2,1-2H3,(H,26,27,31) |
| InChIKey | QLYIYWDTAHPVTH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|