C30H14N2O12 — CID 100934969
bis(4-nitrophenyl) 2,9-dioxochromeno[6,7-g]chromene-3,8-dicarboxylate (PubChem CID 100934969) has the molecular formula C30H14N2O12 and a molecular weight of 594.44 g/mol. Its IUPAC name is bis(4-nitrophenyl) 2,9-dioxochromeno[6,7-g]chromene-3,8-dicarboxylate.
| Compound Name | bis(4-nitrophenyl) 2,9-dioxochromeno[6,7-g]chromene-3,8-dicarboxylate |
|---|---|
| PubChem CID | 100934969 |
| Molecular Formula | C30H14N2O12 |
| Molecular Weight | 594.44 g/mol |
| Exact Mass | 594.05 |
| IUPAC Name | bis(4-nitrophenyl) 2,9-dioxochromeno[6,7-g]chromene-3,8-dicarboxylate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)c1cc2cc3cc4cc(C(=O)Oc5ccc([N+](=O)[O-])cc5)c(=O)oc4cc3cc2oc1=O |
| InChI | InChI=1S/C30H14N2O12/c33-27(41-21-5-1-19(2-6-21)31(37)38)23-11-17-9-15-10-18-12-24(28(34)42-22-7-3-20(4-8-22)32(39)40)30(36)44-26(18)14-16(15)13-25(17)43-29(23)35/h1-14H |
| InChIKey | QGVJDZRTGGGOTR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 199.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|