C42H48O9 — CID 100935683
11,14,17,20,33,36,39,42,45-nonaoxaheptacyclo[28.17.1.13,46.19,22.128,32.05,10.021,26]henpentaconta-1(47),2,5,7,9,21,23,25,28,30,32(50),46(49)-dodecaene (PubChem CID 100935683) has the molecular formula C42H48O9 and a molecular weight of 696.84 g/mol. Its IUPAC name is 11,14,17,20,33,36,39,42,45-nonaoxaheptacyclo[28.17.1.13,46.19,22.128,32.05,10.021,26]henpentaconta-1(47),2,5,7,9,21,23,25,28,30,32(50),46(49)-dodecaene.
| Compound Name | 11,14,17,20,33,36,39,42,45-nonaoxaheptacyclo[28.17.1.13,46.19,22.128,32.05,10.021,26]henpentaconta-1(47),2,5,7,9,21,23,25,28,30,32(50),46(49)-dodecaene |
|---|---|
| PubChem CID | 100935683 |
| Molecular Formula | C42H48O9 |
| Molecular Weight | 696.84 g/mol |
| Exact Mass | 696.33 |
| IUPAC Name | 11,14,17,20,33,36,39,42,45-nonaoxaheptacyclo[28.17.1.13,46.19,22.128,32.05,10.021,26]henpentaconta-1(47),2,5,7,9,21,23,25,28,30,32(50),46(49)-dodecaene |
| SMILES | c1cc2c3c(c1)Cc1cccc(c1OCCOCCOCCO3)Cc1cc3cc(c1)OCCOCCOCCOCCOc1cc(cc(c1)C2)C3 |
| InChI | InChI=1S/C42H48O9/c1-3-35-24-33-22-31-21-32-23-34(29-40(27-32)49-18-14-45-10-8-43-7-9-44-13-17-48-39(26-31)28-33)25-36-4-2-6-38-30-37(5-1)41(35)50-19-15-46-11-12-47-16-20-51-42(36)38/h1-6,22-23,26-29H,7-21,24-25,30H2 |
| InChIKey | LWXFLCHPXDMNLP-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.84 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |