C34H32I2O6 — CID 10533304
9,15-diiodo-25,28,31,34-tetraoxahexacyclo[21.12.1.17,11.113,17.05,35.019,24]octatriaconta-1(35),2,4,7(38),8,10,13,15,17(37),19,21,23-dodecaene-37,38-diol (PubChem CID 10533304) has the molecular formula C34H32I2O6 and a molecular weight of 790.43 g/mol. Its IUPAC name is 9,15-diiodo-25,28,31,34-tetraoxahexacyclo[21.12.1.17,11.113,17.05,35.019,24]octatriaconta-1(35),2,4,7(38),8,10,13,15,17(37),19,21,23-dodecaene-37,38-diol.
| Compound Name | 9,15-diiodo-25,28,31,34-tetraoxahexacyclo[21.12.1.17,11.113,17.05,35.019,24]octatriaconta-1(35),2,4,7(38),8,10,13,15,17(37),19,21,23-dodecaene-37,38-diol |
|---|---|
| PubChem CID | 10533304 |
| Molecular Formula | C34H32I2O6 |
| Molecular Weight | 790.43 g/mol |
| Exact Mass | 790.03 |
| IUPAC Name | 9,15-diiodo-25,28,31,34-tetraoxahexacyclo[21.12.1.17,11.113,17.05,35.019,24]octatriaconta-1(35),2,4,7(38),8,10,13,15,17(37),19,21,23-dodecaene-37,38-diol |
| SMILES | Oc1c2cc(I)cc1Cc1cccc3c1OCCOCCOCCOc1c(cccc1C3)Cc1cc(I)cc(c1O)C2 |
| InChI | InChI=1S/C34H32I2O6/c35-29-17-25-14-23-5-1-3-21-13-22-4-2-6-24(34(22)42-12-10-40-8-7-39-9-11-41-33(21)23)15-26-18-30(36)20-28(32(26)38)16-27(19-29)31(25)37/h1-6,17-20,37-38H,7-16H2 |
| InChIKey | PSSUHZDRESLNLY-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.43 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|