C39H36N6 — CID 100936160
2-N,4-N-bis[(1R)-1-naphthalen-1-ylethyl]-2-N-[(1S)-1-naphthalen-1-ylethyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 100936160) has the molecular formula C39H36N6 and a molecular weight of 588.76 g/mol. Its IUPAC name is 2-N,4-N-bis[(1R)-1-naphthalen-1-ylethyl]-2-N-[(1S)-1-naphthalen-1-ylethyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-bis[(1R)-1-naphthalen-1-ylethyl]-2-N-[(1S)-1-naphthalen-1-ylethyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 100936160 |
| Molecular Formula | C39H36N6 |
| Molecular Weight | 588.76 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | 2-N,4-N-bis[(1R)-1-naphthalen-1-ylethyl]-2-N-[(1S)-1-naphthalen-1-ylethyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | C[C@H](c1cccc2ccccc12)N(c1nc(N)nc(N[C@H](C)c2cccc3ccccc23)n1)[C@@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C39H36N6/c1-25(31-22-10-16-28-13-4-7-19-34(28)31)41-38-42-37(40)43-39(44-38)45(26(2)32-23-11-17-29-14-5-8-20-35(29)32)27(3)33-24-12-18-30-15-6-9-21-36(30)33/h4-27H,1-3H3,(H3,40,41,42,43,44)/t25-,26-,27+/m1/s1 |
| InChIKey | OGTMRXMNSWWTDK-PFBJBMPXSA-N |
| XLogP | 9.42 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.76 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |