C25H37ClN10 — CID 162334300
(3R,5S)-1-[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-(1-naphthalen-1-ylethylamino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine;hydrochloride (PubChem CID 162334300) has the molecular formula C25H37ClN10 and a molecular weight of 513.09 g/mol. Its IUPAC name is (3R,5S)-1-[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-(1-naphthalen-1-ylethylamino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine;hydrochloride.
| Compound Name | (3R,5S)-1-[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-(1-naphthalen-1-ylethylamino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 162334300 |
| Molecular Formula | C25H37ClN10 |
| Molecular Weight | 513.09 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | (3R,5S)-1-[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-(1-naphthalen-1-ylethylamino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine;hydrochloride |
| SMILES | CC(Nc1nc(N2C[C@H](N)C[C@H](N)C2)nc(N2C[C@H](N)C[C@H](N)C2)n1)c1cccc2ccccc12.Cl |
| InChI | InChI=1S/C25H36N10.ClH/c1-15(21-8-4-6-16-5-2-3-7-22(16)21)30-23-31-24(34-11-17(26)9-18(27)12-34)33-25(32-23)35-13-19(28)10-20(29)14-35;/h2-8,15,17-20H,9-14,26-29H2,1H3,(H,30,31,32,33);1H/t15?,17-,18+,19-,20+; |
| InChIKey | JTEWIPGYUYCLNT-IDYCYGRZSA-N |
| XLogP | 1.35 |
| TPSA | 161.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.09 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |