C31H26ClN5 — CID 10577433
2-N-[(1R)-1-anthracen-9-ylethyl]-6-chloro-4-N-[(1R)-1-naphthalen-1-ylethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 10577433) has the molecular formula C31H26ClN5 and a molecular weight of 504.04 g/mol. Its IUPAC name is 2-N-[(1R)-1-anthracen-9-ylethyl]-6-chloro-4-N-[(1R)-1-naphthalen-1-ylethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(1R)-1-anthracen-9-ylethyl]-6-chloro-4-N-[(1R)-1-naphthalen-1-ylethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 10577433 |
| Molecular Formula | C31H26ClN5 |
| Molecular Weight | 504.04 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 2-N-[(1R)-1-anthracen-9-ylethyl]-6-chloro-4-N-[(1R)-1-naphthalen-1-ylethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | C[C@@H](Nc1nc(Cl)nc(N[C@H](C)c2c3ccccc3cc3ccccc23)n1)c1cccc2ccccc12 |
| InChI | InChI=1S/C31H26ClN5/c1-19(24-17-9-13-21-10-3-6-14-25(21)24)33-30-35-29(32)36-31(37-30)34-20(2)28-26-15-7-4-11-22(26)18-23-12-5-8-16-27(23)28/h3-20H,1-2H3,(H2,33,34,35,36,37)/t19-,20-/m1/s1 |
| InChIKey | VYWXUILPLNCNLF-WOJBJXKFSA-N |
| XLogP | 8.33 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.04 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|