C21H23N3 — CID 141396230
(1S,4S)-4-(4-methylimidazol-1-yl)-N-[(1R)-1-naphthalen-1-ylethyl]cyclopent-2-en-1-amine (PubChem CID 141396230) has the molecular formula C21H23N3 and a molecular weight of 317.44 g/mol. Its IUPAC name is (1S,4S)-4-(4-methylimidazol-1-yl)-N-[(1R)-1-naphthalen-1-ylethyl]cyclopent-2-en-1-amine.
| Compound Name | (1S,4S)-4-(4-methylimidazol-1-yl)-N-[(1R)-1-naphthalen-1-ylethyl]cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 141396230 |
| Molecular Formula | C21H23N3 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | (1S,4S)-4-(4-methylimidazol-1-yl)-N-[(1R)-1-naphthalen-1-ylethyl]cyclopent-2-en-1-amine |
| SMILES | Cc1cn([C@@H]2C=C[C@@H](N[C@H](C)c3cccc4ccccc34)C2)cn1 |
| InChI | InChI=1S/C21H23N3/c1-15-13-24(14-22-15)19-11-10-18(12-19)23-16(2)20-9-5-7-17-6-3-4-8-21(17)20/h3-11,13-14,16,18-19,23H,12H2,1-2H3/t16-,18-,19-/m1/s1 |
| InChIKey | PFZVDLVDDLQFBX-BHIYHBOVSA-N |
| XLogP | 4.57 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|