C21H31N3O6S — CID 100936971
[(E)-but-2-enyl] 2-[3-[[(2S)-3-methyl-2-[(4-methylphenyl)sulfonylamino]butanoyl]amino]propanoylamino]acetate (PubChem CID 100936971) has the molecular formula C21H31N3O6S and a molecular weight of 453.56 g/mol. Its IUPAC name is [(E)-but-2-enyl] 2-[3-[[(2S)-3-methyl-2-[(4-methylphenyl)sulfonylamino]butanoyl]amino]propanoylamino]acetate.
| Compound Name | [(E)-but-2-enyl] 2-[3-[[(2S)-3-methyl-2-[(4-methylphenyl)sulfonylamino]butanoyl]amino]propanoylamino]acetate |
|---|---|
| PubChem CID | 100936971 |
| Molecular Formula | C21H31N3O6S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | [(E)-but-2-enyl] 2-[3-[[(2S)-3-methyl-2-[(4-methylphenyl)sulfonylamino]butanoyl]amino]propanoylamino]acetate |
| SMILES | C/C=C/COC(=O)CNC(=O)CCNC(=O)[C@@H](NS(=O)(=O)c1ccc(C)cc1)C(C)C |
| InChI | InChI=1S/C21H31N3O6S/c1-5-6-13-30-19(26)14-23-18(25)11-12-22-21(27)20(15(2)3)24-31(28,29)17-9-7-16(4)8-10-17/h5-10,15,20,24H,11-14H2,1-4H3,(H,22,27)(H,23,25)/b6-5+/t20-/m0/s1 |
| InChIKey | BITNKYARGKCVLH-XJDXJNMNSA-N |
| XLogP | 1.04 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|