C19H26N9O9P+ — CID 100938790
CID 100938790 (PubChem CID 100938790) has the molecular formula C19H26N9O9P+ and a molecular weight of 555.45 g/mol.
| Compound Name | CID 100938790 |
|---|---|
| PubChem CID | 100938790 |
| Molecular Formula | C19H26N9O9P+ |
| Molecular Weight | 555.45 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | — |
| SMILES | Cc1cn([C@H]2C[C@H]([N][N+]#N)[C@@H](CO[P+]([O-])(ON)OC[C@@H]3CC[C@H](n4ccc(N)nc4=O)O3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H26N9O9P/c1-10-7-28(19(31)24-17(10)29)16-6-12(25-26-21)13(36-16)9-34-38(32,37-22)33-8-11-2-3-15(35-11)27-5-4-14(20)23-18(27)30/h4-5,7,11-13,15-16H,2-3,6,8-9,22H2,1H3,(H2,20,23,30)(H,24,29,31)/q+1/t11-,12-,13+,15+,16+,38?/m0/s1 |
| InChIKey | MGAMYKQEPIXXNJ-SNWSAIRRSA-N |
| XLogP | -1.65 |
| TPSA | 253.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.45 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|