C40H57N3O14P2+ — CID 102412485
CID 102412485 (PubChem CID 102412485) has the molecular formula C40H57N3O14P2+ and a molecular weight of 865.85 g/mol.
| Compound Name | CID 102412485 |
|---|---|
| PubChem CID | 102412485 |
| Molecular Formula | C40H57N3O14P2+ |
| Molecular Weight | 865.85 g/mol |
| Exact Mass | 865.33 |
| IUPAC Name | — |
| SMILES | CCCCCCCC(=O)Oc1ccc(CO[P+]([O-])(OCc2ccc(OC(=[O+])CCCCCCC)cc2)O[P+]([O-])(ON)OC[C@@H]2CC[C@H](n3cc(C)c(=O)[nH]c3=O)O2)cc1 |
| InChI | InChI=1S/C40H57N3O14P2/c1-4-6-8-10-12-14-37(44)54-33-20-16-31(17-21-33)27-50-58(48,51-28-32-18-22-34(23-19-32)55-38(45)15-13-11-9-7-5-2)57-59(49,56-41)52-29-35-24-25-36(53-35)43-26-30(3)39(46)42-40(43)47/h16-23,26,35-36H,4-15,24-25,27-29,41H2,1-3H3,(H,42,46,47)/q+1/t35-,36+,59?/m0/s1 |
| InChIKey | BYBUSJOVNOTKEC-BLAYNGGHSA-N |
| XLogP | 6.49 |
| TPSA | 237.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.85 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|