C22H25N3O2S2 — CID 10094064
5-(4-methylphenyl)-4-methylsulfanyl-3-(4-nitrophenyl)-2-piperidin-1-yl-2H-1,3-thiazole (PubChem CID 10094064) has the molecular formula C22H25N3O2S2 and a molecular weight of 427.60 g/mol. Its IUPAC name is 5-(4-methylphenyl)-4-methylsulfanyl-3-(4-nitrophenyl)-2-piperidin-1-yl-2H-1,3-thiazole.
| Compound Name | 5-(4-methylphenyl)-4-methylsulfanyl-3-(4-nitrophenyl)-2-piperidin-1-yl-2H-1,3-thiazole |
|---|---|
| PubChem CID | 10094064 |
| Molecular Formula | C22H25N3O2S2 |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 5-(4-methylphenyl)-4-methylsulfanyl-3-(4-nitrophenyl)-2-piperidin-1-yl-2H-1,3-thiazole |
| SMILES | CSC1=C(c2ccc(C)cc2)SC(N2CCCCC2)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H25N3O2S2/c1-16-6-8-17(9-7-16)20-21(28-2)24(18-10-12-19(13-11-18)25(26)27)22(29-20)23-14-4-3-5-15-23/h6-13,22H,3-5,14-15H2,1-2H3 |
| InChIKey | OOTPVZHWEFLNFL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|