C21H30N2 — CID 100941437
(3S)-N,1-dicyclohexyl-3-phenylazetidin-2-imine (PubChem CID 100941437) has the molecular formula C21H30N2 and a molecular weight of 310.48 g/mol. Its IUPAC name is (3S)-N,1-dicyclohexyl-3-phenylazetidin-2-imine.
| Compound Name | (3S)-N,1-dicyclohexyl-3-phenylazetidin-2-imine |
|---|---|
| PubChem CID | 100941437 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | (3S)-N,1-dicyclohexyl-3-phenylazetidin-2-imine |
| SMILES | c1ccc([C@H]2CN(C3CCCCC3)/C2=N\C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H30N2/c1-4-10-17(11-5-1)20-16-23(19-14-8-3-9-15-19)21(20)22-18-12-6-2-7-13-18/h1,4-5,10-11,18-20H,2-3,6-9,12-16H2/b22-21-/t20-/m1/s1 |
| InChIKey | BSSGKMMKHITBPD-VWKSNAFDSA-N |
| XLogP | 5.15 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|