C11H13IN4O4 — CID 100942181
1-[(2S)-3-azido-2-iodopropyl]-2,5-dimethoxy-3-nitrobenzene (PubChem CID 100942181) has the molecular formula C11H13IN4O4 and a molecular weight of 392.15 g/mol. Its IUPAC name is 1-[(2S)-3-azido-2-iodopropyl]-2,5-dimethoxy-3-nitrobenzene.
| Compound Name | 1-[(2S)-3-azido-2-iodopropyl]-2,5-dimethoxy-3-nitrobenzene |
|---|---|
| PubChem CID | 100942181 |
| Molecular Formula | C11H13IN4O4 |
| Molecular Weight | 392.15 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 1-[(2S)-3-azido-2-iodopropyl]-2,5-dimethoxy-3-nitrobenzene |
| SMILES | COc1cc(C[C@H](I)CN=[N+]=[N-])c(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H13IN4O4/c1-19-9-4-7(3-8(12)6-14-15-13)11(20-2)10(5-9)16(17)18/h4-5,8H,3,6H2,1-2H3/t8-/m0/s1 |
| InChIKey | QZDDCQNRADPVFH-QMMMGPOBSA-N |
| XLogP | 3.27 |
| TPSA | 110.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.15 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|