C37H48FNO2 — CID 100942257
N-[(E,2R,5R)-5-fluoro-1-trityloxydodec-3-en-2-yl]hexanamide (PubChem CID 100942257) has the molecular formula C37H48FNO2 and a molecular weight of 557.79 g/mol. Its IUPAC name is N-[(E,2R,5R)-5-fluoro-1-trityloxydodec-3-en-2-yl]hexanamide.
| Compound Name | N-[(E,2R,5R)-5-fluoro-1-trityloxydodec-3-en-2-yl]hexanamide |
|---|---|
| PubChem CID | 100942257 |
| Molecular Formula | C37H48FNO2 |
| Molecular Weight | 557.79 g/mol |
| Exact Mass | 557.37 |
| IUPAC Name | N-[(E,2R,5R)-5-fluoro-1-trityloxydodec-3-en-2-yl]hexanamide |
| SMILES | CCCCCCC[C@@H](F)/C=C/[C@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)CCCCC |
| InChI | InChI=1S/C37H48FNO2/c1-3-5-7-8-19-26-34(38)28-29-35(39-36(40)27-12-6-4-2)30-41-37(31-20-13-9-14-21-31,32-22-15-10-16-23-32)33-24-17-11-18-25-33/h9-11,13-18,20-25,28-29,34-35H,3-8,12,19,26-27,30H2,1-2H3,(H,39,40)/b29-28+/t34-,35-/m1/s1 |
| InChIKey | ZAMHAQSURGLLRV-QZIQJYPISA-N |
| XLogP | 9.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.79 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|