C13H17N7O10P2 — CID 100943103
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] imidazol-1-yl hydrogen phosphate (PubChem CID 100943103) has the molecular formula C13H17N7O10P2 and a molecular weight of 493.27 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] imidazol-1-yl hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] imidazol-1-yl hydrogen phosphate |
|---|---|
| PubChem CID | 100943103 |
| Molecular Formula | C13H17N7O10P2 |
| Molecular Weight | 493.27 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] imidazol-1-yl hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)On2ccnc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H17N7O10P2/c14-11-8-12(17-4-16-11)20(6-18-8)13-10(22)9(21)7(28-13)3-27-31(23,24)30-32(25,26)29-19-2-1-15-5-19/h1-2,4-7,9-10,13,21-22H,3H2,(H,23,24)(H,25,26)(H2,14,16,17)/t7-,9-,10-,13-/m1/s1 |
| InChIKey | XNGLYMKHZQEIIT-QYVSTXNMSA-N |
| XLogP | -1.41 |
| TPSA | 239.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.27 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|