C45H48 — CID 100943417
3,9,15-tri(cyclohexylidene)-6,12,18-tri(propan-2-ylidene)cyclooctadeca-1,4,7,10,13,16-hexayne (PubChem CID 100943417) has the molecular formula C45H48 and a molecular weight of 588.88 g/mol. Its IUPAC name is 3,9,15-tri(cyclohexylidene)-6,12,18-tri(propan-2-ylidene)cyclooctadeca-1,4,7,10,13,16-hexayne.
| Compound Name | 3,9,15-tri(cyclohexylidene)-6,12,18-tri(propan-2-ylidene)cyclooctadeca-1,4,7,10,13,16-hexayne |
|---|---|
| PubChem CID | 100943417 |
| Molecular Formula | C45H48 |
| Molecular Weight | 588.88 g/mol |
| Exact Mass | 588.38 |
| IUPAC Name | 3,9,15-tri(cyclohexylidene)-6,12,18-tri(propan-2-ylidene)cyclooctadeca-1,4,7,10,13,16-hexayne |
| SMILES | CC(C)=c1c#cc(=C2CCCCC2)c#cc(=C(C)C)c#cc(=C2CCCCC2)c#cc(=C(C)C)c#cc(=C2CCCCC2)c#c1 |
| InChI | InChI=1S/C45H48/c1-34(2)37-22-28-43(40-16-10-7-11-17-40)30-24-38(35(3)4)26-32-45(42-20-14-9-15-21-42)33-27-39(36(5)6)25-31-44(29-23-37)41-18-12-8-13-19-41/h7-21H2,1-6H3 |
| InChIKey | WPRVHZYJXJYMGE-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.88 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |