C38H38 — CID 100943418
8,14-di(cyclohexylidene)-5,11,17-tri(propan-2-ylidene)cycloheptadeca-1,3,6,9,12,15-hexayne (PubChem CID 100943418) has the molecular formula C38H38 and a molecular weight of 494.72 g/mol. Its IUPAC name is 8,14-di(cyclohexylidene)-5,11,17-tri(propan-2-ylidene)cycloheptadeca-1,3,6,9,12,15-hexayne.
| Compound Name | 8,14-di(cyclohexylidene)-5,11,17-tri(propan-2-ylidene)cycloheptadeca-1,3,6,9,12,15-hexayne |
|---|---|
| PubChem CID | 100943418 |
| Molecular Formula | C38H38 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | 8,14-di(cyclohexylidene)-5,11,17-tri(propan-2-ylidene)cycloheptadeca-1,3,6,9,12,15-hexayne |
| SMILES | CC(C)=C1C#CC#CC(=C(C)C)C#CC(=C2CCCCC2)C#CC(=C(C)C)C#CC(=C2CCCCC2)C#C1 |
| InChI | InChI=1S/C38H38/c1-29(2)32-15-13-14-16-33(30(3)4)22-26-38(36-19-11-8-12-20-36)28-24-34(31(5)6)23-27-37(25-21-32)35-17-9-7-10-18-35/h7-12,17-20H2,1-6H3 |
| InChIKey | JOXLUBIKPBGMSC-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|