C32H44 — CID 15363825
1,4-bis(2,2,8,8-tetramethylnona-3,6-diyn-5-ylidene)cyclohexane (PubChem CID 15363825) has the molecular formula C32H44 and a molecular weight of 428.70 g/mol. Its IUPAC name is 1,4-bis(2,2,8,8-tetramethylnona-3,6-diyn-5-ylidene)cyclohexane.
| Compound Name | 1,4-bis(2,2,8,8-tetramethylnona-3,6-diyn-5-ylidene)cyclohexane |
|---|---|
| PubChem CID | 15363825 |
| Molecular Formula | C32H44 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.34 |
| IUPAC Name | 1,4-bis(2,2,8,8-tetramethylnona-3,6-diyn-5-ylidene)cyclohexane |
| SMILES | CC(C)(C)C#CC(C#CC(C)(C)C)=C1CCC(=C(C#CC(C)(C)C)C#CC(C)(C)C)CC1 |
| InChI | InChI=1S/C32H44/c1-29(2,3)21-17-27(18-22-30(4,5)6)25-13-15-26(16-14-25)28(19-23-31(7,8)9)20-24-32(10,11)12/h13-16H2,1-12H3 |
| InChIKey | CZADIRXCPQEDOH-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|