C25H38 — CID 135010411
(E)-7-butyl-8-hex-1-ynylpentadec-7-en-5,9-diyne (PubChem CID 135010411) has the molecular formula C25H38 and a molecular weight of 338.58 g/mol. Its IUPAC name is (E)-7-butyl-8-hex-1-ynylpentadec-7-en-5,9-diyne.
| Compound Name | (E)-7-butyl-8-hex-1-ynylpentadec-7-en-5,9-diyne |
|---|---|
| PubChem CID | 135010411 |
| Molecular Formula | C25H38 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.30 |
| IUPAC Name | (E)-7-butyl-8-hex-1-ynylpentadec-7-en-5,9-diyne |
| SMILES | CCCCC#C/C(C#CCCCCC)=C(\C#CCCCC)CCCC |
| InChI | InChI=1S/C25H38/c1-5-9-13-16-19-23-25(22-18-15-11-7-3)24(20-12-8-4)21-17-14-10-6-2/h5-16,20H2,1-4H3/b25-24+ |
| InChIKey | OBRLAHDTSLVLLN-OCOZRVBESA-N |
| XLogP | 7.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|